CAS 889062-06-0 appears in our catalog under these names: Amicarbazone Impurity 2, N-tert-Butyl-3-(2-hydroxypropan-2-yl)-5-oxo-4,5-dihydro-1H-1,2,4-triazole-1-carboxamide, >95% (HPLC), Amicarbazone-desamino-1-hydroxyisopropyl. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer. Available pack sizes: on request, 100mg, 50mg, 10mg.
N-tert-butyl-3-(2-hydroxypropan-2-yl)-5-oxo-4H-1,2,4-triazole-1-carboxamide (CAS 889062-06-0) is a chemical compound with the molecular formula C10H18N4O3 and a molecular weight of 242.28 g/mol. IUPAC name: N-tert-butyl-3-(2-hydroxypropan-2-yl)-5-oxo-4H-1,2,4-triazole-1-carboxamide. InChIKey: RLWLJHDVGCZVBM-UHFFFAOYSA-N.
| Molecular formula | C10H18N4O3 |
|---|---|
| Molecular weight | 242.28 g/mol |
| IUPAC name | N-tert-butyl-3-(2-hydroxypropan-2-yl)-5-oxo-4H-1,2,4-triazole-1-carboxamide |
| InChIKey | RLWLJHDVGCZVBM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)N1C(=O)NC(=N1)C(C)(C)O |
Computed by PubChem (NCBI)