Products 88918-76-7
CAS 88918-76-7 appears in our catalog under these names: Sumatriptan Impurity 16, 3-(Cyanomethyl)-N-methyl-1H-indole-5-methanesulfonamide. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 25mg, 10mg, 50mg.
1-[3-(cyanomethyl)-1H-indol-5-yl]-N-methylmethanesulfonamide (CAS 88918-76-7) is a chemical compound with the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. IUPAC name: 1-[3-(cyanomethyl)-1H-indol-5-yl]-N-methylmethanesulfonamide. InChIKey: HYBOCMIZDNGJEY-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O2S |
|---|---|
| Molecular weight | 263.32 g/mol |
| IUPAC name | 1-[3-(cyanomethyl)-1H-indol-5-yl]-N-methylmethanesulfonamide |
| InChIKey | HYBOCMIZDNGJEY-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)CC1=CC2=C(C=C1)NC=C2CC#N |
Computed by PubChem (NCBI)