CAS 88933-16-8 appears in our catalog under these names: 4-Hydrazino-N-methyl Benzene Methanesulfonamide Hydrochloride Salt, >95% (HPLC), 4-Hydrazino-N-methyl benzene methanesulfonamide, hydrochloride (1:1), 4-Hydrazino-N-methylbenzenemethanesulfonamide hydrochloride, 97%, 97%, 1-(4-Hydrazinylphenyl)-N-methylmethanesulfonamide hydrochloride, 97%. Offered by: TRC, Biosynth, Chemat, Fluorochem. Available pack sizes: 500mg, 50g, 1g, 5g, 10g, 25g, 100g.
1-(4-hydrazinylphenyl)-N-methylmethanesulfonamide;hydrochloride (CAS 88933-16-8) is a chemical compound with the molecular formula C8H14ClN3O2S and a molecular weight of 251.73 g/mol. IUPAC name: 1-(4-hydrazinylphenyl)-N-methylmethanesulfonamide;hydrochloride. InChIKey: WZZPGBAXFSIKJJ-UHFFFAOYSA-N.
| Molecular formula | C8H14ClN3O2S |
|---|---|
| Molecular weight | 251.73 g/mol |
| IUPAC name | 1-(4-hydrazinylphenyl)-N-methylmethanesulfonamide;hydrochloride |
| InChIKey | WZZPGBAXFSIKJJ-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)CC1=CC=C(C=C1)NN.Cl |
Computed by PubChem (NCBI)