CAS 889659-00-1 is the registry number for Inositol phosphate amide-C5-NH2. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(1R,2S,3S,4R,5S,6R)-2,3,4,6-tetrahydroxy-5-phosphonooxycyclohexyl] N-(5-aminopentyl)carbamate (CAS 889659-00-1) is a chemical compound with the molecular formula C12H25N2O10P and a molecular weight of 388.31 g/mol. IUPAC name: [(1R,2S,3S,4R,5S,6R)-2,3,4,6-tetrahydroxy-5-phosphonooxycyclohexyl] N-(5-aminopentyl)carbamate. InChIKey: KUKKVGORBDRIFA-LVGGVBNSSA-N.
| Molecular formula | C12H25N2O10P |
|---|---|
| Molecular weight | 388.31 g/mol |
| IUPAC name | [(1R,2S,3S,4R,5S,6R)-2,3,4,6-tetrahydroxy-5-phosphonooxycyclohexyl] N-(5-aminopentyl)carbamate |
| InChIKey | KUKKVGORBDRIFA-LVGGVBNSSA-N |
| SMILES | C(CCN)CCNC(=O)O[C@@H]1[C@H]([C@@H]([C@H]([C@@H]([C@@H]1O)OP(=O)(O)O)O)O)O |
Computed by PubChem (NCBI)