Products 88977-31-5
CAS 88977-31-5 is the registry number for Demethyl Propionitrile Isradipine, >95% (HPLC). Offered by: TRC. Available pack sizes: 50mg.
3-O-(2-cyanoethyl) 5-O-propan-2-yl 4-(2,1,3-benzoxadiazol-4-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (CAS 88977-31-5) is a chemical compound with the molecular formula C21H22N4O5 and a molecular weight of 410.4 g/mol. IUPAC name: 3-O-(2-cyanoethyl) 5-O-propan-2-yl 4-(2,1,3-benzoxadiazol-4-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: KXPYQWROKBMFAG-UHFFFAOYSA-N.
| Molecular formula | C21H22N4O5 |
|---|---|
| Molecular weight | 410.4 g/mol |
| IUPAC name | 3-O-(2-cyanoethyl) 5-O-propan-2-yl 4-(2,1,3-benzoxadiazol-4-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | KXPYQWROKBMFAG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OC(C)C)C2=CC=CC3=NON=C32)C(=O)OCCC#N |
Computed by PubChem (NCBI)
Synonyms:
Demethyl Propionitrile Isradipine