CAS 889797-65-3 is the registry number for DNMT1-IN-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(3,6-dichlorocarbazol-9-yl)-3-[2-(1H-indol-3-yl)ethylamino]propan-2-ol (CAS 889797-65-3) is a chemical compound with the molecular formula C25H23Cl2N3O and a molecular weight of 452.4 g/mol. IUPAC name: 1-(3,6-dichlorocarbazol-9-yl)-3-[2-(1H-indol-3-yl)ethylamino]propan-2-ol. InChIKey: BBTFHKNAZNYZNG-UHFFFAOYSA-N.
| Molecular formula | C25H23Cl2N3O |
|---|---|
| Molecular weight | 452.4 g/mol |
| IUPAC name | 1-(3,6-dichlorocarbazol-9-yl)-3-[2-(1H-indol-3-yl)ethylamino]propan-2-ol |
| InChIKey | BBTFHKNAZNYZNG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCNCC(CN3C4=C(C=C(C=C4)Cl)C5=C3C=CC(=C5)Cl)O |
Computed by PubChem (NCBI)