CAS 889959-22-2 is the registry number for CYP19A1-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-chloro-N-[1-(4-imidazol-1-ylphenyl)ethyl]-2-oxochromene-3-carboxamide (CAS 889959-22-2) is a chemical compound with the molecular formula C21H16ClN3O3 and a molecular weight of 393.8 g/mol. IUPAC name: 6-chloro-N-[1-(4-imidazol-1-ylphenyl)ethyl]-2-oxochromene-3-carboxamide. InChIKey: JHLPBFOWDHHRBC-UHFFFAOYSA-N.
| Molecular formula | C21H16ClN3O3 |
|---|---|
| Molecular weight | 393.8 g/mol |
| IUPAC name | 6-chloro-N-[1-(4-imidazol-1-ylphenyl)ethyl]-2-oxochromene-3-carboxamide |
| InChIKey | JHLPBFOWDHHRBC-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)N2C=CN=C2)NC(=O)C3=CC4=C(C=CC(=C4)Cl)OC3=O |
Computed by PubChem (NCBI)