Products 89-04-3

CAS 89-04-3 is the registry number for 1,2,4-Trioctyl Ester 1,2,4-Benzenetricarboxylic Acid. Offered by: TRC. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Trioctyl benzene-1,2,4-tricarboxylate (CAS 89-04-3) is a chemical compound with the molecular formula C33H54O6 and a molecular weight of 546.8 g/mol. IUPAC name: trioctyl benzene-1,2,4-tricarboxylate. InChIKey: JNXDCMUUZNIWPQ-UHFFFAOYSA-N.

Identity
Molecular formulaC33H54O6
Molecular weight546.8 g/mol
IUPAC nametrioctyl benzene-1,2,4-tricarboxylate
InChIKeyJNXDCMUUZNIWPQ-UHFFFAOYSA-N
SMILESCCCCCCCCOC(=O)C1=CC(=C(C=C1)C(=O)OCCCCCCCC)C(=O)OCCCCCCCC

Computed by PubChem (NCBI)