Products 89-58-7
CAS 89-58-7 appears in our catalog under these names: 2,5-Dimethylnitrobenzene, 95%, 2,5–Dimethylnitrobenzene, 2,5-Dimethylnitrobenzene, 2,5-Dimethylnitrobenzene, >99.0%(GC), 1，4-Dimethyl-2-nitrobenzene, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 5g, 25g, 100g, 1g, 500g, 50g, 250g, 75g.
1,4-dimethyl-2-nitrobenzene (CAS 89-58-7) is a chemical compound with the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. IUPAC name: 1,4-dimethyl-2-nitrobenzene. InChIKey: BSFHJMGROOFSRA-UHFFFAOYSA-N.
| Molecular formula | C8H9NO2 |
|---|---|
| Molecular weight | 151.16 g/mol |
| IUPAC name | 1,4-dimethyl-2-nitrobenzene |
| InChIKey | BSFHJMGROOFSRA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)