CAS 89004-82-0 appears in our catalog under these names: Potassium bis(Boc)amide, 95%, Di–tert–butyl iminodicarboxylate (potassium), Di-tert-butyl iminodicarboxylate (potassium), 95%, Potassium Bis(Boc)amide, 95%, 95%. Offered by: Combi-blocks, GLPBio, Fluorochem, Chemat. Available pack sizes: 10g, 25g, 1g, 5g, 250mg, 100mg.
Potassium bis[(2-methylpropan-2-yl)oxycarbonyl]azanide (CAS 89004-82-0) is a chemical compound with the molecular formula C10H18KNO4 and a molecular weight of 255.35 g/mol. IUPAC name: potassium bis[(2-methylpropan-2-yl)oxycarbonyl]azanide. InChIKey: IFXGTCUBGXFGIC-UHFFFAOYSA-M.
| Molecular formula | C10H18KNO4 |
|---|---|
| Molecular weight | 255.35 g/mol |
| IUPAC name | potassium bis[(2-methylpropan-2-yl)oxycarbonyl]azanide |
| InChIKey | IFXGTCUBGXFGIC-UHFFFAOYSA-M |
| SMILES | CC(C)(C)OC(=O)[N-]C(=O)OC(C)(C)C.[K+] |
Computed by PubChem (NCBI)