CAS 890087-21-5 appears in our catalog under these names: LUF6000, LUF6000, 99+%, 2-Cyclohexyl-N-(3,4-dichlorophenyl)-3H-imidazo[4,5-c]quinolin-4-amine, 98%, 98%, LUF6000, 99.09%. Offered by: GLPBio, AmBeed, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 100mg, 50mg, 25mg, 10mM/1mL, 50 mg, 25 mg.
2-cyclohexyl-N-(3,4-dichlorophenyl)-3H-imidazo[4,5-c]quinolin-4-amine (CAS 890087-21-5) is a chemical compound with the molecular formula C22H20Cl2N4 and a molecular weight of 411.3 g/mol. IUPAC name: 2-cyclohexyl-N-(3,4-dichlorophenyl)-3H-imidazo[4,5-c]quinolin-4-amine. InChIKey: UWJVRSIGHHSDSJ-UHFFFAOYSA-N.
| Molecular formula | C22H20Cl2N4 |
|---|---|
| Molecular weight | 411.3 g/mol |
| IUPAC name | 2-cyclohexyl-N-(3,4-dichlorophenyl)-3H-imidazo[4,5-c]quinolin-4-amine |
| InChIKey | UWJVRSIGHHSDSJ-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=NC3=C(N2)C(=NC4=CC=CC=C43)NC5=CC(=C(C=C5)Cl)Cl |
Computed by PubChem (NCBI)