Products 890090-41-2
CAS 890090-41-2 is the registry number for FAM NHS ester, 6-isomer. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (CAS 890090-41-2) is a chemical compound with the molecular formula C25H15NO9 and a molecular weight of 473.4 g/mol. IUPAC name: 4-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid. InChIKey: LXFOCXWFKJWFEP-UHFFFAOYSA-N.
| Molecular formula | C25H15NO9 |
|---|---|
| Molecular weight | 473.4 g/mol |
| IUPAC name | 4-(2,5-dioxopyrrolidin-1-yl)oxycarbonyl-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| InChIKey | LXFOCXWFKJWFEP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)C2=CC(=C(C=C2)C(=O)O)C3=C4C=CC(=O)C=C4OC5=C3C=CC(=C5)O |
Computed by PubChem (NCBI)