CAS 890098-18-7 appears in our catalog under these names: 3-Chloro-4'-iodobenzophenone, 95+%, 3-Chloro-4'-iodobenzophenone. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
(3-chlorophenyl)-(4-iodophenyl)methanone (CAS 890098-18-7) is a chemical compound with the molecular formula C13H8ClIO and a molecular weight of 342.56 g/mol. IUPAC name: (3-chlorophenyl)-(4-iodophenyl)methanone. InChIKey: NSCIJVCHILXIHI-UHFFFAOYSA-N.
| Molecular formula | C13H8ClIO |
|---|---|
| Molecular weight | 342.56 g/mol |
| IUPAC name | (3-chlorophenyl)-(4-iodophenyl)methanone |
| InChIKey | NSCIJVCHILXIHI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(=O)C2=CC=C(C=C2)I |
Computed by PubChem (NCBI)