CAS 89011-17-6 appears in our catalog under these names: 3,5-Diiodo-4-hydroxybenzhydrazide, 95%, 3,5-Diiodo-4-hydroxybenzhydrazide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 50mg, 500mg, 1000mg.
4-hydroxy-3,5-diiodobenzohydrazide (CAS 89011-17-6) is a chemical compound with the molecular formula C7H6I2N2O2 and a molecular weight of 403.94 g/mol. IUPAC name: 4-hydroxy-3,5-diiodobenzohydrazide. InChIKey: VTEWBWJTYCPLPR-UHFFFAOYSA-N.
| Molecular formula | C7H6I2N2O2 |
|---|---|
| Molecular weight | 403.94 g/mol |
| IUPAC name | 4-hydroxy-3,5-diiodobenzohydrazide |
| InChIKey | VTEWBWJTYCPLPR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1I)O)I)C(=O)NN |
Computed by PubChem (NCBI)