CAS 890146-60-8 appears in our catalog under these names: 3-(Dibenzylamino)-2,2-difluoropropanoic acid 95%, 3-(Dibenzylamino)-2,2-difluoropropanoic acid, 97%, 97%, 3-(Dibenzylamino)-2,2-difluoropropanoic acid, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-(dibenzylamino)-2,2-difluoropropanoic acid (CAS 890146-60-8) is a chemical compound with the molecular formula C17H17F2NO2 and a molecular weight of 305.32 g/mol. IUPAC name: 3-(dibenzylamino)-2,2-difluoropropanoic acid. InChIKey: PIMXRMKJPFZDGP-UHFFFAOYSA-N.
| Molecular formula | C17H17F2NO2 |
|---|---|
| Molecular weight | 305.32 g/mol |
| IUPAC name | 3-(dibenzylamino)-2,2-difluoropropanoic acid |
| InChIKey | PIMXRMKJPFZDGP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN(CC2=CC=CC=C2)CC(C(=O)O)(F)F |
Computed by PubChem (NCBI)