Products 890302-17-7
CAS 890302-17-7 is the registry number for 5-Piperazin-1-yl-2-(trifluoromethyl)-1,6-naphthyridine, 95%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
5-piperazin-1-yl-2-(trifluoromethyl)-1,6-naphthyridine (CAS 890302-17-7) is a chemical compound with the molecular formula C13H13F3N4 and a molecular weight of 282.26 g/mol. IUPAC name: 5-piperazin-1-yl-2-(trifluoromethyl)-1,6-naphthyridine. InChIKey: MIBMFJKAPFQBRL-UHFFFAOYSA-N.
| Molecular formula | C13H13F3N4 |
|---|---|
| Molecular weight | 282.26 g/mol |
| IUPAC name | 5-piperazin-1-yl-2-(trifluoromethyl)-1,6-naphthyridine |
| InChIKey | MIBMFJKAPFQBRL-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC=CC3=C2C=CC(=N3)C(F)(F)F |
Computed by PubChem (NCBI)