Products 89051-49-0
CAS 89051-49-0 appears in our catalog under these names: Tazobactam Acid Impurity 14, Tazobactam Impurity U, Tazobactam Impurity 18. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Benzhydryl (2S,3S,5R)-3-(azidomethyl)-3-methyl-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (CAS 89051-49-0) is a chemical compound with the molecular formula C21H20N4O5S and a molecular weight of 440.5 g/mol. IUPAC name: benzhydryl (2S,3S,5R)-3-(azidomethyl)-3-methyl-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate. InChIKey: AWBQXKUUUONXEK-LMNJBCLMSA-N.
| Molecular formula | C21H20N4O5S |
|---|---|
| Molecular weight | 440.5 g/mol |
| IUPAC name | benzhydryl (2S,3S,5R)-3-(azidomethyl)-3-methyl-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| InChIKey | AWBQXKUUUONXEK-LMNJBCLMSA-N |
| SMILES | C[C@@]1([C@@H](N2[C@H](S1(=O)=O)CC2=O)C(=O)OC(C3=CC=CC=C3)C4=CC=CC=C4)CN=[N+]=[N-] |
Computed by PubChem (NCBI)
Synonyms:
Tazobactam Impurity U