CAS 89057-44-3 appears in our catalog under these names: 5,5,10,10–Tetramethyl–5,10–dihydroindeno(2,1–a)indene, 5,5,10,10-Tetramethyl-5,10-dihydroindeno[2,1-a]indene, 98%, 98%, 5,5,10,10-Tetramethyl-5,10-dihydroindeno[2,1-a]indene, 95%, 5,5,10,10-Tetramethyl-5,10-dihydroindeno[2,1-a]indene, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
5,5,10,10-tetramethylindeno[2,1-a]indene (CAS 89057-44-3) is a chemical compound with the molecular formula C20H20 and a molecular weight of 260.4 g/mol. IUPAC name: 5,5,10,10-tetramethylindeno[2,1-a]indene. InChIKey: QWHZIRWZLWBQBB-UHFFFAOYSA-N.
| Molecular formula | C20H20 |
|---|---|
| Molecular weight | 260.4 g/mol |
| IUPAC name | 5,5,10,10-tetramethylindeno[2,1-a]indene |
| InChIKey | QWHZIRWZLWBQBB-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C4=CC=CC=C4C3(C)C)C |
Computed by PubChem (NCBI)