CAS 89059-38-1 is the registry number for Aniline-13C6 Hydrochloride. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
(1,2,3,4,5,6-13C6)cyclohexatrienamine;hydrochloride (CAS 89059-38-1) is a chemical compound with the molecular formula C6H8ClN and a molecular weight of 135.54 g/mol. IUPAC name: (1,2,3,4,5,6-13C6)cyclohexatrienamine;hydrochloride. InChIKey: MMCPOSDMTGQNKG-BVNCJLROSA-N.
| Molecular formula | C6H8ClN |
|---|---|
| Molecular weight | 135.54 g/mol |
| IUPAC name | (1,2,3,4,5,6-13C6)cyclohexatrienamine;hydrochloride |
| InChIKey | MMCPOSDMTGQNKG-BVNCJLROSA-N |
| SMILES | [13CH]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)N.Cl |
Computed by PubChem (NCBI)