CAS 89059-40-5 is the registry number for 3,4-Dichloroaniline-13C6. Offered by: TRC. Available pack sizes: 10mg, 1mg.
3,4-dichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-amine (CAS 89059-40-5) is a chemical compound with the molecular formula C6H5Cl2N and a molecular weight of 167.97 g/mol. IUPAC name: 3,4-dichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-amine. InChIKey: SDYWXFYBZPNOFX-IDEBNGHGSA-N.
| Molecular formula | C6H5Cl2N |
|---|---|
| Molecular weight | 167.97 g/mol |
| IUPAC name | 3,4-dichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-amine |
| InChIKey | SDYWXFYBZPNOFX-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13C]([13CH]=[13C]1N)Cl)Cl |
Computed by PubChem (NCBI)