Products 89075-43-4
CAS 89075-43-4 appears in our catalog under these names: 2-(2-fluorophenyl)-3H-imidazo[4,5-c]pyridine, 96%, 2-(2-Fluorophenyl)-1H-imidazo[4,5-c]pyridine, 99%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(2-fluorophenyl)-3H-imidazo[4,5-c]pyridine (CAS 89075-43-4) is a chemical compound with the molecular formula C12H8FN3 and a molecular weight of 213.21 g/mol. IUPAC name: 2-(2-fluorophenyl)-3H-imidazo[4,5-c]pyridine. InChIKey: DFXVIZQVJLSYOJ-UHFFFAOYSA-N.
| Molecular formula | C12H8FN3 |
|---|---|
| Molecular weight | 213.21 g/mol |
| IUPAC name | 2-(2-fluorophenyl)-3H-imidazo[4,5-c]pyridine |
| InChIKey | DFXVIZQVJLSYOJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC3=C(N2)C=NC=C3)F |
Computed by PubChem (NCBI)