CAS 89084-60-6 is the registry number for 3-Descarboxy Imazethapyr. Offered by: TRC. Available pack sizes: 2,5g.
2-(5-ethyl-2-pyridinyl)-4-methyl-4-propan-2-yl-1H-imidazol-5-one (CAS 89084-60-6) is a chemical compound with the molecular formula C14H19N3O and a molecular weight of 245.32 g/mol. IUPAC name: 2-(5-ethyl-2-pyridinyl)-4-methyl-4-propan-2-yl-1H-imidazol-5-one. InChIKey: VJPWANUEKPAZNG-UHFFFAOYSA-N.
| Molecular formula | C14H19N3O |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | 2-(5-ethyl-2-pyridinyl)-4-methyl-4-propan-2-yl-1H-imidazol-5-one |
| InChIKey | VJPWANUEKPAZNG-UHFFFAOYSA-N |
| SMILES | CCC1=CN=C(C=C1)C2=NC(C(=O)N2)(C)C(C)C |
Computed by PubChem (NCBI)