Products 891018-44-3
CAS 891018-44-3 is the registry number for N-((phenylamino)carbonylamino)-2-(3-(trifluoromethyl)phenoxy)ethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
1-phenyl-3-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]urea (CAS 891018-44-3) is a chemical compound with the molecular formula C16H14F3N3O3 and a molecular weight of 353.30 g/mol. IUPAC name: 1-phenyl-3-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]urea. InChIKey: IGNOFJDIKCXHSF-UHFFFAOYSA-N.
| Molecular formula | C16H14F3N3O3 |
|---|---|
| Molecular weight | 353.30 g/mol |
| IUPAC name | 1-phenyl-3-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]urea |
| InChIKey | IGNOFJDIKCXHSF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)NNC(=O)COC2=CC=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)