CAS 89108-46-3 appears in our catalog under these names: N-(4-Aminobutyl)-2-naphthalenesulfonamide hydrochloride, 95%, N-(4-Aminobutyl)-2-naphthalenesulfonamide Hydrochloride, >95% (HPLC), N-(4-Aminobutyl)naphthalene-2-sulfonamide hydrochloride, 98%, N–(4–Aminobutyl)–2–naphthalenesulfonamide Hydrochloride, N-(4-AMINOBUTYL)-2-NAPHTHALENESULFONAMIDE HCL, 98.0%, 98.0%. Offered by: Combi-blocks, TRC, AmBeed, GLPBio, Chemat. Available pack sizes: 500mg, 25mg, 1g, 100mg.
N-(4-aminobutyl)naphthalene-2-sulfonamide;hydrochloride (CAS 89108-46-3) is a chemical compound with the molecular formula C14H19ClN2O2S and a molecular weight of 314.8 g/mol. IUPAC name: N-(4-aminobutyl)naphthalene-2-sulfonamide;hydrochloride. InChIKey: WYFVKUWCEVMLOL-UHFFFAOYSA-N.
| Molecular formula | C14H19ClN2O2S |
|---|---|
| Molecular weight | 314.8 g/mol |
| IUPAC name | N-(4-aminobutyl)naphthalene-2-sulfonamide;hydrochloride |
| InChIKey | WYFVKUWCEVMLOL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)S(=O)(=O)NCCCCN.Cl |
Computed by PubChem (NCBI)