CAS 89114-74-9 appears in our catalog under these names: Diphenyl(4-styrylphenyl)amine, 95%, 4-Styryltriphenylamine, 98%, 4–Styryltriphenylamine, 4-Styryltriphenylamine, >98.0%(GC), 4-Styryltriphenylamine. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg.
N,N-diphenyl-4-(2-phenylethenyl)aniline (CAS 89114-74-9) is a chemical compound with the molecular formula C26H21N and a molecular weight of 347.4 g/mol. IUPAC name: N,N-diphenyl-4-(2-phenylethenyl)aniline. InChIKey: DXYYLUGHPCHMRQ-UHFFFAOYSA-N.
| Molecular formula | C26H21N |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | N,N-diphenyl-4-(2-phenylethenyl)aniline |
| InChIKey | DXYYLUGHPCHMRQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C=CC2=CC=C(C=C2)N(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)