CAS 89131-10-2 appears in our catalog under these names: Dabsyl-l-alanine, 95%, Dabsyl–L–alanine, Dabsyl-L-alanine, ≥95%(HPLC), ≥95%(HPLC). Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 100mg, 500mg, 10mg.
(2S)-2-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]propanoic acid (CAS 89131-10-2) is a chemical compound with the molecular formula C17H20N4O4S and a molecular weight of 376.4 g/mol. IUPAC name: (2S)-2-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]propanoic acid. InChIKey: MSJGMRRFQPODJE-LBPRGKRZSA-N.
| Molecular formula | C17H20N4O4S |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | (2S)-2-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]propanoic acid |
| InChIKey | MSJGMRRFQPODJE-LBPRGKRZSA-N |
| SMILES | C[C@@H](C(=O)O)NS(=O)(=O)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)N(C)C |
Computed by PubChem (NCBI)