CAS 89131-12-4 appears in our catalog under these names: Dabsyl-l-leucine, 95%, Dabsyl-L-leucine. Offered by: Combi-blocks, Chemat. Available pack sizes: 100mg, 250mg, 10mg.
(2S)-2-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]-4-methylpentanoic acid (CAS 89131-12-4) is a chemical compound with the molecular formula C20H26N4O4S and a molecular weight of 418.5 g/mol. IUPAC name: (2S)-2-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]-4-methylpentanoic acid. InChIKey: DYCBTNVNACPQRN-IBGZPJMESA-N.
| Molecular formula | C20H26N4O4S |
|---|---|
| Molecular weight | 418.5 g/mol |
| IUPAC name | (2S)-2-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]-4-methylpentanoic acid |
| InChIKey | DYCBTNVNACPQRN-IBGZPJMESA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NS(=O)(=O)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)N(C)C |
Computed by PubChem (NCBI)