CAS 89141-50-4 appears in our catalog under these names: Melarsomine dihydrochloride, Melarsomine Dihydrochloride, Melarsomine (dihydrochloride), 95.35%. Offered by: GLPBio, TRC, Biosynth, MedChemExpress. Available pack sizes: 50mg, 25mg, 5mg, 10mg, 1mg, 5 mg, 10 mg, 25 mg.
2-N-[4-[bis(2-aminoethylsulfanyl)arsanyl]phenyl]-1,3,5-triazine-2,4,6-triamine;dihydrochloride (CAS 89141-50-4) is a chemical compound with the molecular formula C13H23AsCl2N8S2 and a molecular weight of 501.3 g/mol. IUPAC name: 2-N-[4-[bis(2-aminoethylsulfanyl)arsanyl]phenyl]-1,3,5-triazine-2,4,6-triamine;dihydrochloride. InChIKey: WMZUMAJTJUZEKQ-UHFFFAOYSA-N.
| Molecular formula | C13H23AsCl2N8S2 |
|---|---|
| Molecular weight | 501.3 g/mol |
| IUPAC name | 2-N-[4-[bis(2-aminoethylsulfanyl)arsanyl]phenyl]-1,3,5-triazine-2,4,6-triamine;dihydrochloride |
| InChIKey | WMZUMAJTJUZEKQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=NC(=NC(=N2)N)N)[As](SCCN)SCCN.Cl.Cl |
Computed by PubChem (NCBI)