CAS 89157-97-1 is the registry number for 1,6-Anhydro-2,3,4-tri-O-benzyl-β-L-idopyranose. Offered by: Chemat. Available pack sizes: 100mg, 1g, 250mg, 500mg.
(1S,2R,3S,4R,5S)-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane (CAS 89157-97-1) is a chemical compound with the molecular formula C27H28O5 and a molecular weight of 432.5 g/mol. IUPAC name: (1S,2R,3S,4R,5S)-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane. InChIKey: JSRSLTCFTYHIRT-HYFAGJRRSA-N.
| Molecular formula | C27H28O5 |
|---|---|
| Molecular weight | 432.5 g/mol |
| IUPAC name | (1S,2R,3S,4R,5S)-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane |
| InChIKey | JSRSLTCFTYHIRT-HYFAGJRRSA-N |
| SMILES | C1[C@H]2[C@H]([C@@H]([C@H]([C@@H](O1)O2)OCC3=CC=CC=C3)OCC4=CC=CC=C4)OCC5=CC=CC=C5 |
Computed by PubChem (NCBI)