Products 891632-80-7
CAS 891632-80-7 is the registry number for 1-(2-(2,4-dimethylphenoxy)acetyl)-4-(4-nitrophenyl)thiosemicarbazide. Offered by: Biosynth. Available pack sizes: 250mg.
1-[[2-(2,4-dimethylphenoxy)acetyl]amino]-3-(4-nitrophenyl)thiourea (CAS 891632-80-7) is a chemical compound with the molecular formula C17H18N4O4S and a molecular weight of 374.4 g/mol. IUPAC name: 1-[[2-(2,4-dimethylphenoxy)acetyl]amino]-3-(4-nitrophenyl)thiourea. InChIKey: FDAKMRRIGCZIEW-UHFFFAOYSA-N.
| Molecular formula | C17H18N4O4S |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | 1-[[2-(2,4-dimethylphenoxy)acetyl]amino]-3-(4-nitrophenyl)thiourea |
| InChIKey | FDAKMRRIGCZIEW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OCC(=O)NNC(=S)NC2=CC=C(C=C2)[N+](=O)[O-])C |
Computed by PubChem (NCBI)