CAS 89166-98-3 appears in our catalog under these names: 3,4,5-Trichloropyridin-2-ol, 95%, 3,4,5–Trichloropyridin–2–ol. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 10g, 5g, 1g, 250mg.
3,4,5-trichloro-1H-pyridin-2-one (CAS 89166-98-3) is a chemical compound with the molecular formula C5H2Cl3NO and a molecular weight of 198.43 g/mol. IUPAC name: 3,4,5-trichloro-1H-pyridin-2-one. InChIKey: IHZPCKHNCXIHTO-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl3NO |
|---|---|
| Molecular weight | 198.43 g/mol |
| IUPAC name | 3,4,5-trichloro-1H-pyridin-2-one |
| InChIKey | IHZPCKHNCXIHTO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=O)N1)Cl)Cl)Cl |
Computed by PubChem (NCBI)