CAS 891782-29-9 appears in our catalog under these names: (R)-N-Cyclopentylidene-2-methylpropane-2-sulfinamide, 95%, (R)–N–Cyclopentylidene–2–methylpropane–2–sulfinamide, (R)-N-Cyclopentylidene-2-methylpropane-2-sulfinamide. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 2,5g.
(R)-N-cyclopentylidene-2-methylpropane-2-sulfinamide (CAS 891782-29-9) is a chemical compound with the molecular formula C9H17NOS and a molecular weight of 187.30 g/mol. IUPAC name: (R)-N-cyclopentylidene-2-methylpropane-2-sulfinamide. InChIKey: NLMAXOUUSMPKKX-GFCCVEGCSA-N.
| Molecular formula | C9H17NOS |
|---|---|
| Molecular weight | 187.30 g/mol |
| IUPAC name | (R)-N-cyclopentylidene-2-methylpropane-2-sulfinamide |
| InChIKey | NLMAXOUUSMPKKX-GFCCVEGCSA-N |
| SMILES | CC(C)(C)[S@@](=O)N=C1CCCC1 |
Computed by PubChem (NCBI)