Products 89180-62-1

CAS 89180-62-1 is the registry number for 2-Sulfanyl-1,3-thiazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-sulfanylidene-3H-1,3-thiazole-4-carboxylic acid (CAS 89180-62-1) is a chemical compound with the molecular formula C4H3NO2S2 and a molecular weight of 161.2 g/mol. IUPAC name: 2-sulfanylidene-3H-1,3-thiazole-4-carboxylic acid. InChIKey: UZWWFFJHMATGGR-UHFFFAOYSA-N.

Identity
Molecular formulaC4H3NO2S2
Molecular weight161.2 g/mol
IUPAC name2-sulfanylidene-3H-1,3-thiazole-4-carboxylic acid
InChIKeyUZWWFFJHMATGGR-UHFFFAOYSA-N
SMILESC1=C(NC(=S)S1)C(=O)O

Computed by PubChem (NCBI)