CAS 89182-60-5 is the registry number for N-Formyl-1-amino-1-deoxy-D-glucitol. Offered by: Biosynth. Available pack sizes: 25g, 10g, 50g, 100g.
N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]formamide (CAS 89182-60-5) is a chemical compound with the molecular formula C7H15NO6 and a molecular weight of 209.20 g/mol. IUPAC name: N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]formamide. InChIKey: ILXGPMLOFSWMBU-BDVNFPICSA-N.
| Molecular formula | C7H15NO6 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]formamide |
| InChIKey | ILXGPMLOFSWMBU-BDVNFPICSA-N |
| SMILES | C([C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O)NC=O |
Computed by PubChem (NCBI)