Products 892157-47-0
CAS 892157-47-0 appears in our catalog under these names: 1-(4-Aminophenyl)-2,2-dimethylpropan-1-one, 95%, 1-(4-Aminophenyl)-2,2-dimethylpropan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
1-(4-aminophenyl)-2,2-dimethylpropan-1-one (CAS 892157-47-0) is a chemical compound with the molecular formula C11H15NO and a molecular weight of 177.24 g/mol. IUPAC name: 1-(4-aminophenyl)-2,2-dimethylpropan-1-one. InChIKey: IMKFGDHZVCABHA-UHFFFAOYSA-N.
| Molecular formula | C11H15NO |
|---|---|
| Molecular weight | 177.24 g/mol |
| IUPAC name | 1-(4-aminophenyl)-2,2-dimethylpropan-1-one |
| InChIKey | IMKFGDHZVCABHA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C1=CC=C(C=C1)N |
Computed by PubChem (NCBI)