CAS 892286-95-2 is the registry number for 3-[(3-Phenyl-1,2,4-oxadiazol-5-yl)methyl]-1,2,3,4-tetrahydroquinazoline-2,4-dione, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-1H-quinazoline-2,4-dione (CAS 892286-95-2) is a chemical compound with the molecular formula C17H12N4O3 and a molecular weight of 320.30 g/mol. IUPAC name: 3-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-1H-quinazoline-2,4-dione. InChIKey: TYOHOESDNWCGPE-UHFFFAOYSA-N.
| Molecular formula | C17H12N4O3 |
|---|---|
| Molecular weight | 320.30 g/mol |
| IUPAC name | 3-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-1H-quinazoline-2,4-dione |
| InChIKey | TYOHOESDNWCGPE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC(=N2)CN3C(=O)C4=CC=CC=C4NC3=O |
Computed by PubChem (NCBI)