Products 892299-50-2
CAS 892299-50-2 appears in our catalog under these names: 8-Methyl-3-phenyl-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione, 90%, 8–Methyl–3–phenyl–1，4，8–triazaspiro–(4·5)dec–3–ene–2–thione. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 500mg.
8-methyl-3-phenyl-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione (CAS 892299-50-2) is a chemical compound with the molecular formula C14H17N3S and a molecular weight of 259.37 g/mol. IUPAC name: 8-methyl-3-phenyl-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione. InChIKey: YOTXRAMOGZFEOJ-UHFFFAOYSA-N.
| Molecular formula | C14H17N3S |
|---|---|
| Molecular weight | 259.37 g/mol |
| IUPAC name | 8-methyl-3-phenyl-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione |
| InChIKey | YOTXRAMOGZFEOJ-UHFFFAOYSA-N |
| SMILES | CN1CCC2(CC1)NC(=S)C(=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)