CAS 89238-99-3 appears in our catalog under these names: 4-Methoxybenzyl 2,2,2-trichloroacetimidate, 97%, 4–Methoxybenzyl 2,2,2–Trichloroacetimidate, 4-Methoxybenzyl 2,2,2-Trichloroacetimidate, >96.0%(GC), 4-Methoxybenzyl 2,2,2-trichloroacetimidate 96%, 4-METHOXYBENZYL-2,2,2-TRICHLOROACETIMID&. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 10g, 25g, 5g, 1g.
(4-methoxyphenyl)methyl 2,2,2-trichloroethanimidate (CAS 89238-99-3) is a chemical compound with the molecular formula C10H10Cl3NO2 and a molecular weight of 282.5 g/mol. IUPAC name: (4-methoxyphenyl)methyl 2,2,2-trichloroethanimidate. InChIKey: TYHGKLBJBHACOI-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl3NO2 |
|---|---|
| Molecular weight | 282.5 g/mol |
| IUPAC name | (4-methoxyphenyl)methyl 2,2,2-trichloroethanimidate |
| InChIKey | TYHGKLBJBHACOI-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)COC(=N)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)