CAS 892387-29-0 appears in our catalog under these names: 5-Bromo-n'-hydroxythiophene-2-carboximidamide, 95%, 5-Bromo-N'-hydroxythiophene-2-carboximidamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 0,5g.
5-bromo-N'-hydroxythiophene-2-carboximidamide (CAS 892387-29-0) is a chemical compound with the molecular formula C5H5BrN2OS and a molecular weight of 221.08 g/mol. IUPAC name: 5-bromo-N'-hydroxythiophene-2-carboximidamide. InChIKey: HCORWIKGUAIWEX-UHFFFAOYSA-N.
| Molecular formula | C5H5BrN2OS |
|---|---|
| Molecular weight | 221.08 g/mol |
| IUPAC name | 5-bromo-N'-hydroxythiophene-2-carboximidamide |
| InChIKey | HCORWIKGUAIWEX-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Br)/C(=N/O)/N |
Computed by PubChem (NCBI)