CAS 892397-56-7 is the registry number for 2–(Methoxy–d3)–bromobenzene. Offered by: GLPBio. Available pack sizes: 20mg.
1-bromo-2-(trideuteriomethoxy)benzene (CAS 892397-56-7) is a chemical compound with the molecular formula C7H7BrO and a molecular weight of 190.05 g/mol. IUPAC name: 1-bromo-2-(trideuteriomethoxy)benzene. InChIKey: HTDQSWDEWGSAMN-FIBGUPNXSA-N.
| Molecular formula | C7H7BrO |
|---|---|
| Molecular weight | 190.05 g/mol |
| IUPAC name | 1-bromo-2-(trideuteriomethoxy)benzene |
| InChIKey | HTDQSWDEWGSAMN-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC=CC=C1Br |
Computed by PubChem (NCBI)