Products 892572-23-5

CAS 892572-23-5 is the registry number for YT-8-8, 98.57%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 5 mg, 50 mg, 25 mg, 10 mg.

Structural formula: {0} (CAS {1})

2-[2-[[3-[(4-fluorophenyl)methoxy]phenyl]methylamino]ethylamino]ethanol (CAS 892572-23-5) is a chemical compound with the molecular formula C18H23FN2O2 and a molecular weight of 318.4 g/mol. IUPAC name: 2-[2-[[3-[(4-fluorophenyl)methoxy]phenyl]methylamino]ethylamino]ethanol. InChIKey: QTYLDSBXZVEWQC-UHFFFAOYSA-N.

Identity
Molecular formulaC18H23FN2O2
Molecular weight318.4 g/mol
IUPAC name2-[2-[[3-[(4-fluorophenyl)methoxy]phenyl]methylamino]ethylamino]ethanol
InChIKeyQTYLDSBXZVEWQC-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)OCC2=CC=C(C=C2)F)CNCCNCCO

Computed by PubChem (NCBI)

Synonyms: orb2646067