CAS 892606-01-8 is the registry number for N-(2,3-Dichlorobenzyl)-4H-1,2,4-triazol-4-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(2,3-dichlorophenyl)methyl]-1,2,4-triazol-4-amine (CAS 892606-01-8) is a chemical compound with the molecular formula C9H8Cl2N4 and a molecular weight of 243.09 g/mol. IUPAC name: N-[(2,3-dichlorophenyl)methyl]-1,2,4-triazol-4-amine. InChIKey: XFAUFAROIDBKCG-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2N4 |
|---|---|
| Molecular weight | 243.09 g/mol |
| IUPAC name | N-[(2,3-dichlorophenyl)methyl]-1,2,4-triazol-4-amine |
| InChIKey | XFAUFAROIDBKCG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)CNN2C=NN=C2 |
Computed by PubChem (NCBI)