Products 892664-17-4
CAS 892664-17-4 is the registry number for GSK-269984B. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-[[5-chloro-2-[(4-chloro-2-fluorophenyl)methoxy]phenyl]methyl]pyridine-2-carboxylic acid (CAS 892664-17-4) is a chemical compound with the molecular formula C20H14Cl2FNO3 and a molecular weight of 406.2 g/mol. IUPAC name: 6-[[5-chloro-2-[(4-chloro-2-fluorophenyl)methoxy]phenyl]methyl]pyridine-2-carboxylic acid. InChIKey: HJPAXYLYYQIFCK-UHFFFAOYSA-N.
| Molecular formula | C20H14Cl2FNO3 |
|---|---|
| Molecular weight | 406.2 g/mol |
| IUPAC name | 6-[[5-chloro-2-[(4-chloro-2-fluorophenyl)methoxy]phenyl]methyl]pyridine-2-carboxylic acid |
| InChIKey | HJPAXYLYYQIFCK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)C(=O)O)CC2=C(C=CC(=C2)Cl)OCC3=C(C=C(C=C3)Cl)F |
Computed by PubChem (NCBI)