CAS 892693-46-8 is the registry number for (4-[4-(5-Chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl)amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[4-(4-aminophenyl)piperazin-1-yl]-(5-chloro-2-methoxyphenyl)methanone (CAS 892693-46-8) is a chemical compound with the molecular formula C18H20ClN3O2 and a molecular weight of 345.8 g/mol. IUPAC name: [4-(4-aminophenyl)piperazin-1-yl]-(5-chloro-2-methoxyphenyl)methanone. InChIKey: NFPVNXYQTBPQHO-UHFFFAOYSA-N.
| Molecular formula | C18H20ClN3O2 |
|---|---|
| Molecular weight | 345.8 g/mol |
| IUPAC name | [4-(4-aminophenyl)piperazin-1-yl]-(5-chloro-2-methoxyphenyl)methanone |
| InChIKey | NFPVNXYQTBPQHO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Cl)C(=O)N2CCN(CC2)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)