CAS 89283-73-8 appears in our catalog under these names: 1,2-Dicyano-3-Hydroxyprop-2-Ene Potassium Salt, 95%, 95%, 1,2-Dicyano-3-hydroxyprop-2-ene potassium salt, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
Potassium (Z)-2,3-dicyanoprop-1-en-1-olate (CAS 89283-73-8) is a chemical compound with the molecular formula C5H3KN2O and a molecular weight of 146.19 g/mol. IUPAC name: potassium (Z)-2,3-dicyanoprop-1-en-1-olate. InChIKey: KDIFOFDRTJDTPV-MKWAYWHRSA-M.
| Molecular formula | C5H3KN2O |
|---|---|
| Molecular weight | 146.19 g/mol |
| IUPAC name | potassium (Z)-2,3-dicyanoprop-1-en-1-olate |
| InChIKey | KDIFOFDRTJDTPV-MKWAYWHRSA-M |
| SMILES | C(C#N)/C(=C/[O-])/C#N.[K+] |
Computed by PubChem (NCBI)