CAS 893-69-6 appears in our catalog under these names: Ethyldiphenylsulfonium tetrafluoroborate, 97%, 97%, ETHYLDIPHENYLSULFONIUM TETRAFLUOROBORATE, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Ethyl(diphenyl)sulfanium tetrafluoroborate (CAS 893-69-6) is a chemical compound with the molecular formula C14H15BF4S and a molecular weight of 302.1 g/mol. IUPAC name: ethyl(diphenyl)sulfanium tetrafluoroborate. InChIKey: OMJIKEGJWFKACN-UHFFFAOYSA-N.
| Molecular formula | C14H15BF4S |
|---|---|
| Molecular weight | 302.1 g/mol |
| IUPAC name | ethyl(diphenyl)sulfanium tetrafluoroborate |
| InChIKey | OMJIKEGJWFKACN-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.CC[S+](C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)