CAS 89325-49-5 appears in our catalog under these names: Chloroisobromine cyanuric acid, Chlorobromo Isocyanuric Acid. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-3-chloro-1,3,5-triazinane-2,4,6-trione (CAS 89325-49-5) is a chemical compound with the molecular formula C3HBrClN3O3 and a molecular weight of 242.41 g/mol. IUPAC name: 1-bromo-3-chloro-1,3,5-triazinane-2,4,6-trione. InChIKey: OKNPHOXYVYNIDL-UHFFFAOYSA-N.
| Molecular formula | C3HBrClN3O3 |
|---|---|
| Molecular weight | 242.41 g/mol |
| IUPAC name | 1-bromo-3-chloro-1,3,5-triazinane-2,4,6-trione |
| InChIKey | OKNPHOXYVYNIDL-UHFFFAOYSA-N |
| SMILES | C1(=O)NC(=O)N(C(=O)N1Cl)Br |
Computed by PubChem (NCBI)