CAS 89331-93-1 is the registry number for N,N-Di-p-tolylthiophen-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N,N-bis(4-methylphenyl)thiophen-2-amine (CAS 89331-93-1) is a chemical compound with the molecular formula C18H17NS and a molecular weight of 279.4 g/mol. IUPAC name: N,N-bis(4-methylphenyl)thiophen-2-amine. InChIKey: LVGJJUJVDAJKSR-UHFFFAOYSA-N.
| Molecular formula | C18H17NS |
|---|---|
| Molecular weight | 279.4 g/mol |
| IUPAC name | N,N-bis(4-methylphenyl)thiophen-2-amine |
| InChIKey | LVGJJUJVDAJKSR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N(C2=CC=C(C=C2)C)C3=CC=CS3 |
Computed by PubChem (NCBI)