CAS 89333-12-0 is the registry number for (Z)-3-Hydroxy-2-phenylacrylaldehyde, 97%. Offered by: AmBeed. Available pack sizes: 5g.
(Z)-3-hydroxy-2-phenylprop-2-enal (CAS 89333-12-0) is a chemical compound with the molecular formula C9H8O2 and a molecular weight of 148.16 g/mol. IUPAC name: (Z)-3-hydroxy-2-phenylprop-2-enal. InChIKey: UPAOZWQVAHWEST-RMKNXTFCSA-N.
| Molecular formula | C9H8O2 |
|---|---|
| Molecular weight | 148.16 g/mol |
| IUPAC name | (Z)-3-hydroxy-2-phenylprop-2-enal |
| InChIKey | UPAOZWQVAHWEST-RMKNXTFCSA-N |
| SMILES | C1=CC=C(C=C1)/C(=C/O)/C=O |
Computed by PubChem (NCBI)