CAS 89346-48-5 appears in our catalog under these names: 2-(2-Fluorophenyl)pyridine, 95%, 2-(2-Fluorophenyl)pyridine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
2-(2-fluorophenyl)pyridine (CAS 89346-48-5) is a chemical compound with the molecular formula C11H8FN and a molecular weight of 173.19 g/mol. IUPAC name: 2-(2-fluorophenyl)pyridine. InChIKey: SVAOECAKLGBAEW-UHFFFAOYSA-N.
| Molecular formula | C11H8FN |
|---|---|
| Molecular weight | 173.19 g/mol |
| IUPAC name | 2-(2-fluorophenyl)pyridine |
| InChIKey | SVAOECAKLGBAEW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=CC=N2)F |
Computed by PubChem (NCBI)